|
CAS#: 71720-49-5 Product: 2-Methoxy-4-Nitroanilinium Chloride No suppilers available for the product. |
| Name | 2-Methoxy-4-Nitroanilinium Chloride |
|---|---|
| Synonyms | (2-Methoxy-4-Nitro-Phenyl)Ammonium Chloride; (2-Methoxy-4-Nitrophenyl)Ammonium Chloride; (2-Methoxy-4-Nitro-Phenyl)Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 204.61 |
| CAS Registry Number | 71720-49-5 |
| EINECS | 275-898-2 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1OC)[NH3+].[Cl-] |
| InChI | 1S/C7H8N2O3.ClH/c1-12-7-4-5(9(10)11)2-3-6(7)8;/h2-4H,8H2,1H3;1H |
| InChIKey | FHZJVAOAPCEUAV-UHFFFAOYSA-N |
| Boiling point | 364.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-4-Nitroanilinium Chloride |