|
CAS#: 71750-52-2 Product: (1,5-Dimethylhexyl)Ammonium Sulphate No suppilers available for the product. |
| Name | (1,5-Dimethylhexyl)Ammonium Sulphate |
|---|---|
| Synonyms | 1,5-Dimethylhexylammonium Sulfate; (1,5-Dimethylhexyl)Ammonium Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H20NO4S |
| Molecular Weight | 226.31 |
| CAS Registry Number | 71750-52-2 |
| EINECS | 275-979-2 |
| SMILES | O=[S]([O-])([O-])=O.C(C([NH3+])C)CCC(C)C |
| InChI | 1S/C8H19N.H2O4S/c1-7(2)5-4-6-8(3)9;1-5(2,3)4/h7-8H,4-6,9H2,1-3H3;(H2,1,2,3,4)/p-1 |
| InChIKey | HMGKCYAZWOWMNS-UHFFFAOYSA-M |
| Boiling point | 155°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 48.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,5-Dimethylhexyl)Ammonium Sulphate |