| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-(2-chloroanilino)benzaldehyde |
|---|---|
| Synonyms | 2-(2-chloroanilino)benzaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.68 |
| CAS Registry Number | 71758-44-6 |
| SMILES | c1ccc(c(c1)C=O)Nc2ccccc2Cl |
| InChI | 1S/C13H10ClNO/c14-11-6-2-4-8-13(11)15-12-7-3-1-5-10(12)9-16/h1-9,15H |
| InChIKey | DAAHPDZFLSFYPJ-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.327°C at 760 mmHg (Cal.) |
| Flash point | 162.044°C (Cal.) |
| (1) | Schulze Tobias, Weiss Sara, Schymanski Emma, von der Ohe Peter Carsten, Schmitt-Jansen Mechthild, Altenburger Rolf, Streck Georg, Brack Werner. Identification of a phytotoxic photo-transformation product of diclofenac using effect-directed analysis, Environmental Pollution, 2010 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-chloroanilino)benzaldehyde |