|
CAS#: 71765-95-2 Product: 16-Bromoestrone No suppilers available for the product. |
| Name | 16-Bromoestrone |
|---|---|
| Synonyms | 16-Bromoestrone; 16Alpha-Bromoestrone; Estra-1,3,5(10)-Trien-17-One, 16-Bromo-3-Hydroxy-, (16Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 |
| CAS Registry Number | 71765-95-2 |
| SMILES | [C@@H]23CCC1=C(C=CC(=C1)O)[C@H]2CC[C@]4([C@H]3C[C@H](C4=O)Br)C |
| InChI | 1S/C18H21BrO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-16,20H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | ONEZAEJNFATWNE-QFXBJFAPSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.242°C at 760 mmHg (Cal.) |
| Flash point | 244.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Bromoestrone |