|
CAS#: 71794-60-0 Product: 11 beta-Chloromethylestradiol No suppilers available for the product. |
| Name | 11 beta-Chloromethylestradiol |
|---|---|
| Synonyms | 11Beta-Chloromethylestradiol; C14307; Estra-1,3,5(10)-Triene-3,17-Diol, 11-(Chloromethyl)-, (11Beta,17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25ClO2 |
| Molecular Weight | 320.86 |
| CAS Registry Number | 71794-60-0 |
| SMILES | [C@@H]23C1=CC=C(C=C1CC[C@H]2[C@H]4[C@](C[C@@H]3CCl)([C@H](CC4)O)C)O |
| InChI | 1S/C19H25ClO2/c1-19-9-12(10-20)18-14-5-3-13(21)8-11(14)2-4-15(18)16(19)6-7-17(19)22/h3,5,8,12,15-18,21-22H,2,4,6-7,9-10H2,1H3/t12-,15+,16+,17+,18-,19+/m1/s1 |
| InChIKey | CADGCTOWBAPSFQ-OQFXVXKWSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.075°C at 760 mmHg (Cal.) |
| Flash point | 252.003°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11 beta-Chloromethylestradiol |