| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Name | (1R,2S,5R)-5-Methyl-2-(2-phenyl-2-propanyl)cyclohexyl chloroacetate |
|---|---|
| Synonyms | (+)-8-PHENYLMENTHYLCHLOROACETATE; -8-PHENYLMENTHYLCHLOROACETATE |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.84 |
| CAS Registry Number | 71804-27-8 |
| SMILES | O=C(O[C@H]1[C@@H](CC[C@H](C1)C)C(c2ccccc2)(C)C)CCl |
| InChI | 1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3/t13-,15-,16-/m1/s1 |
| InChIKey | GYWWQECFQIGECM-FVQBIDKESA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.281°C at 760 mmHg (Cal.) |
| Flash point | 188.265°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | F. Sieder, K. Eichinger and K. Mereiter. (1R,2S,5R)-5-Methyl-2-(1-methyl-1-phenylethyl)cyclohexyl chloroacetate, Acta Cryst. (2006). E62, o2291-o2292 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2S,5R)-5-Methyl-2-(2-phenyl-2-propanyl)cyclohexyl chloroacetate |