|
CAS#: 71806-22-9 Product: N-Oleoyl-DL-Tryptophan Ethyl Ester No suppilers available for the product. |
| Name | N-Oleoyl-DL-Tryptophan Ethyl Ester |
|---|---|
| Synonyms | (2S)-3-(1H-Indol-3-Yl)-2-[[(Z)-1-Oxooctadec-9-Enyl]Amino]Propanoic Acid Ethyl Ester; (2S)-3-(1H-Indol-3-Yl)-2-[[(Z)-Octadec-9-Enoyl]Amino]Propionic Acid Ethyl Ester; Compound 57-118 |
| Molecular Structure | ![]() |
| Molecular Formula | C31H48N2O3 |
| Molecular Weight | 496.73 |
| CAS Registry Number | 71806-22-9 |
| SMILES | [C@H](C(=O)OCC)(NC(CCCCCCC\C=C/CCCCCCCC)=O)CC1=C[NH]C2=CC=CC=C12 |
| InChI | 1S/C31H48N2O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-30(34)33-29(31(35)36-4-2)24-26-25-32-28-22-20-19-21-27(26)28/h11-12,19-22,25,29,32H,3-10,13-18,23-24H2,1-2H3,(H,33,34)/b12-11-/t29-/m0/s1 |
| InChIKey | LCMBCJFAKQBFGZ-TWKJZOCOSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 667.81°C at 760 mmHg (Cal.) |
| Flash point | 357.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Oleoyl-DL-Tryptophan Ethyl Ester |