|
CAS#: 71820-49-0 Product: 1-Phenyl-2-Ethyl-1-Hexene-3-One No suppilers available for the product. |
| Name | 1-Phenyl-2-Ethyl-1-Hexene-3-One |
|---|---|
| Synonyms | (3E)-3-(Phenylmethylidene)Heptan-4-One; 3-(Phenylmethylene)Heptan-4-One; (3E)-3-(Phenylmethylene)Heptan-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 |
| CAS Registry Number | 71820-49-0 |
| SMILES | C1=CC=C(C=C1)\C=C(C(=O)CCC)/CC |
| InChI | 1S/C14H18O/c1-3-8-14(15)13(4-2)11-12-9-6-5-7-10-12/h5-7,9-11H,3-4,8H2,1-2H3/b13-11+ |
| InChIKey | YOFZPPBYHUNSNX-ACCUITESSA-N |
| Density | 0.964g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.244°C at 760 mmHg (Cal.) |
| Flash point | 118.303°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-2-Ethyl-1-Hexene-3-One |