|
CAS#: 71823-45-5 Product: alpha-Methyl-1-Phenyl-5-Acenaphtheneacetic Acid No suppilers available for the product. |
| Name | alpha-Methyl-1-Phenyl-5-Acenaphtheneacetic Acid |
|---|---|
| Synonyms | 2-(1-Phenyl-5-Acenaphthenyl)Propanoic Acid; 2-(1-Phenylacenaphthen-5-Yl)Propionic Acid; 5-Acenaphtheneacetic Acid, Alpha-Methyl-1-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 71823-45-5 |
| SMILES | C1=CC(=C2C=CC=C3C(CC1=C23)C4=CC=CC=C4)C(C(=O)O)C |
| InChI | 1S/C21H18O2/c1-13(21(22)23)16-11-10-15-12-19(14-6-3-2-4-7-14)18-9-5-8-17(16)20(15)18/h2-11,13,19H,12H2,1H3,(H,22,23) |
| InChIKey | WSUNJDMZZOKJJT-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.94°C at 760 mmHg (Cal.) |
| Flash point | 387.453°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-1-Phenyl-5-Acenaphtheneacetic Acid |