|
CAS#: 7183-41-7 Product: Erythritol 4-Phosphate No suppilers available for the product. |
| Name | Erythritol 4-Phosphate |
|---|---|
| Synonyms | (2R,3S)-2,3,4-Trihydroxybutyl Dihydrogen Phosphate; 4-O-Phosphono-D-Erythritol; Chebi:15770 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H11O7P |
| Molecular Weight | 202.10 |
| CAS Registry Number | 7183-41-7 |
| SMILES | [C@@H](CO[P](=O)(O)O)([C@H](CO)O)O |
| InChI | 1S/C4H11O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h3-7H,1-2H2,(H2,8,9,10)/t3-,4+/m0/s1 |
| InChIKey | QRDCEYBRRFPBMZ-IUYQGCFVSA-N |
| Density | 1.783g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.793°C at 760 mmHg (Cal.) |
| Flash point | 290.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Erythritol 4-Phosphate |