|
CAS#: 71837-87-1 Product: Methyl (3alpha,5beta,7alpha)-7-acetoxy-3-hydroxy-12-oxocholan-24-oate No suppilers available for the product. |
| Name | Methyl (3alpha,5beta,7alpha)-7-acetoxy-3-hydroxy-12-oxocholan-24-oate |
|---|---|
| Synonyms | methyl (3α,5β,7α)-7-acetoxy-3-hydroxy-12-oxocholan-24-oate |
| Molecular Structure | ![]() |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.62 |
| CAS Registry Number | 71837-87-1 |
| EINECS | 276-058-8 |
| SMILES | O=C(O[C@H]2[C@H]1[C@H]4[C@](C(=O)C[C@@H]1[C@@]3(C)CC[C@@H](O)C[C@H]3C2)([C@H](CC4)[C@H](C)CCC(=O)OC)C)C |
| InChI | 1S/C27H42O6/c1-15(6-9-24(31)32-5)19-7-8-20-25-21(14-23(30)27(19,20)4)26(3)11-10-18(29)12-17(26)13-22(25)33-16(2)28/h15,17-22,25,29H,6-14H2,1-5H3/t15-,17+,18-,19-,20+,21+,22-,25+,26+,27-/m1/s1 |
| InChIKey | MWUBEKFSCVGPKW-OYYDADKJSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.927°C at 760 mmHg (Cal.) |
| Flash point | 173.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (3alpha,5beta,7alpha)-7-acetoxy-3-hydroxy-12-oxocholan-24-oate |