|
CAS#: 71859-30-8 Product: 2,2',4,4',5,5'-Hexachlorodiphenyl Ether No suppilers available for the product. |
| Name | 2,2',4,4',5,5'-Hexachlorodiphenyl Ether |
|---|---|
| Synonyms | Pcde 153; 1,1'-Oxybis(2,4,5-Trichlorobenzene); 2,2',4,4',5,5'-Hexachlorodiphenyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Cl6O |
| Molecular Weight | 376.88 |
| CAS Registry Number | 71859-30-8 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OC2=CC(=C(C=C2Cl)Cl)Cl |
| InChI | 1S/C12H4Cl6O/c13-5-1-9(17)11(3-7(5)15)19-12-4-8(16)6(14)2-10(12)18/h1-4H |
| InChIKey | PECXRRMHOQBOIE-UHFFFAOYSA-N |
| Density | 1.626g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.456°C at 760 mmHg (Cal.) |
| Flash point | 137.545°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',4,4',5,5'-Hexachlorodiphenyl Ether |