|
CAS#: 71872-96-3 Product: 4,5-Dihydro-5-Oxo-1-(4-Sulphophenyl)-1H-Pyrazole-3-Acetic Acid No suppilers available for the product. |
| Name | 4,5-Dihydro-5-Oxo-1-(4-Sulphophenyl)-1H-Pyrazole-3-Acetic Acid |
|---|---|
| Synonyms | 2-[5-Keto-1-(4-Sulfophenyl)-4H-Pyrazol-3-Yl]Acetic Acid; 2-[5-Oxo-1-(4-Sulfophenyl)-4H-Pyrazol-3-Yl]Ethanoic Acid; 4,5-Dihydro-5-Oxo-1-(4-Sulphophenyl)-1H-Pyrazole-3-Acetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2O6S |
| Molecular Weight | 298.27 |
| CAS Registry Number | 71872-96-3 |
| EINECS | 276-105-2 |
| SMILES | C1=C([S](=O)(=O)O)C=CC(=C1)N2N=C(CC(=O)O)CC2=O |
| InChI | 1S/C11H10N2O6S/c14-10-5-7(6-11(15)16)12-13(10)8-1-3-9(4-2-8)20(17,18)19/h1-4H,5-6H2,(H,15,16)(H,17,18,19) |
| InChIKey | BQPLZHXIWFVFRH-UHFFFAOYSA-N |
| Density | 1.679g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydro-5-Oxo-1-(4-Sulphophenyl)-1H-Pyrazole-3-Acetic Acid |