Online Database of Chemicals from Around the World
|
CAS#: 71889-15-1 Product: 4-(1,1-Dimethylethyl)-2-Methyl-6-(1,1,3,3-Tetramethylbutyl)Phenol No suppilers available for the product. |
| Name | 4-(1,1-Dimethylethyl)-2-Methyl-6-(1,1,3,3-Tetramethylbutyl)Phenol |
|---|---|
| Synonyms | 4-Tert-Butyl-2-Methyl-6-(1,1,3,3-Tetramethylbutyl)Phenol; 6-(1,1,3,3-Tetramethylbutyl)-4-Tert-Butyl-2-Cresol; Phenol, 4-(1,1-Dimethylethyl)-2-Methyl-6-(1,1,3,3-Tetramethylbutyl)- |
| Molecular Structure |  |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 |
| CAS Registry Number | 71889-15-1 |
| SMILES | C1=C(C(=C(C=C1C(C)(C)C)C(C)(C)CC(C)(C)C)O)C |
| InChI | 1S/C19H32O/c1-13-10-14(18(5,6)7)11-15(16(13)20)19(8,9)12-17(2,3)4/h10-11,20H,12H2,1-9H3 |
| InChIKey | NRWUHKORTFMBBF-UHFFFAOYSA-N |
| Density | 0.911g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.559°C at 760 mmHg (Cal.) |
| Flash point | 150.272°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1-Dimethylethyl)-2-Methyl-6-(1,1,3,3-Tetramethylbutyl)Phenol |