|
CAS#: 71919-49-8 Product: 3-Chloro-4-cyanophenyl 4-propylbenzoate No suppilers available for the product. |
| Name | 3-Chloro-4-cyanophenyl 4-propylbenzoate |
|---|---|
| Synonyms | 3-Chlor-4-cyanphenyl-4-propylbenzoat; 3-Chloro-4-cyanophenyl 4-propylbenzoate; 4-Propylbenzoate de 3-chloro-4-cyanophényle |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14ClNO2 |
| Molecular Weight | 299.75 |
| CAS Registry Number | 71919-49-8 |
| SMILES | CCCc1ccc(cc1)C(=O)Oc2ccc(c(c2)Cl)C#N |
| InChI | 1S/C17H14ClNO2/c1-2-3-12-4-6-13(7-5-12)17(20)21-15-9-8-14(11-19)16(18)10-15/h4-10H,2-3H2,1H3 |
| InChIKey | CJCXPSXXWIKDTI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 233.5±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-cyanophenyl 4-propylbenzoate |