Online Database of Chemicals from Around the World
| Name | 4-(Allyloxy)-3,5-Dipropylbenzamide |
|---|---|
| Synonyms | 4-Allyloxy-3,5-Diisopropyl-Benzamide; 4-Allyloxy-3,5-Diisopropylbenzamide; 3,5-Di(Propan-2-Yl)-4-Prop-2-Enoxy-Benzamide |
| Molecular Structure |  |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 |
| CAS Registry Number | 7192-63-4 |
| SMILES | C1=C(C=C(C(=C1C(C)C)OCC=C)C(C)C)C(=O)N |
| InChI | 1S/C16H23NO2/c1-6-7-19-15-13(10(2)3)8-12(16(17)18)9-14(15)11(4)5/h6,8-11H,1,7H2,2-5H3,(H2,17,18) |
| InChIKey | IOOQHHCRMGOYJW-UHFFFAOYSA-N |
| Density | 1.004g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.235°C at 760 mmHg (Cal.) |
| Flash point | 103.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Allyloxy)-3,5-Dipropylbenzamide |
