|
CAS#: 71937-01-4 Product: 2-(((4-(2-Propenyloxy)Phenyl)Methylene)Amino)-Benzoic Acid No suppilers available for the product. |
| Name | 2-(((4-(2-Propenyloxy)Phenyl)Methylene)Amino)-Benzoic Acid |
|---|---|
| Synonyms | 2-[(4-Allyloxyphenyl)Methyleneamino]Benzoic Acid; 2-[(4-Allyloxybenzylidene)Amino]Benzoic Acid; 2-(((4-(2-Propenyloxy)Phenyl)Methylene)Amino)Benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 |
| CAS Registry Number | 71937-01-4 |
| SMILES | C2=C(N=CC1=CC=C(OCC=C)C=C1)C(=CC=C2)C(=O)O |
| InChI | 1S/C17H15NO3/c1-2-11-21-14-9-7-13(8-10-14)12-18-16-6-4-3-5-15(16)17(19)20/h2-10,12H,1,11H2,(H,19,20) |
| InChIKey | LWQLUARVXRKPCD-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.254°C at 760 mmHg (Cal.) |
| Flash point | 253.321°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(((4-(2-Propenyloxy)Phenyl)Methylene)Amino)-Benzoic Acid |