|
CAS#: 71965-04-3 Product: 4-Amino-N-Phenyltoluene-3-Sulphonamide No suppilers available for the product. |
| Name | 4-Amino-N-Phenyltoluene-3-Sulphonamide |
|---|---|
| Synonyms | 2-Amino-5-Methyl-N-Phenyl-Benzenesulfonamide; 4-Amino-N-Phenyltoluene-3-Sulphonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 |
| CAS Registry Number | 71965-04-3 |
| EINECS | 276-223-4 |
| SMILES | C1=C(C=CC(=C1[S](=O)(=O)NC2=CC=CC=C2)N)C |
| InChI | 1S/C13H14N2O2S/c1-10-7-8-12(14)13(9-10)18(16,17)15-11-5-3-2-4-6-11/h2-9,15H,14H2,1H3 |
| InChIKey | BIXYENQGVAOIJE-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.646°C at 760 mmHg (Cal.) |
| Flash point | 228.762°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-N-Phenyltoluene-3-Sulphonamide |