|
CAS#: 71998-74-8 Product: 1,2,4,7,9-Pentachlorodibenzofuran No suppilers available for the product. |
| Name | 1,2,4,7,9-Pentachlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,4,7,9-Pentachloro-; Dibenzofuran, 1,2,4,7,9-Pentachloro |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3Cl5O |
| Molecular Weight | 340.42 |
| CAS Registry Number | 71998-74-8 |
| SMILES | C1=C(C=C3C(=C1Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)O3)Cl |
| InChI | 1S/C12H3Cl5O/c13-4-1-5(14)9-8(2-4)18-12-7(16)3-6(15)11(17)10(9)12/h1-3H |
| InChIKey | IYGVHNHWORPMFU-UHFFFAOYSA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.657°C at 760 mmHg (Cal.) |
| Flash point | 222.116°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,7,9-Pentachlorodibenzofuran |