|
CAS#: 72018-27-0 Product: Magnesium Hexyl Sulfate No suppilers available for the product. |
| Name | Magnesium Hexyl Sulfate |
|---|---|
| Synonyms | Hexyl Sulphate, Magnesium Salt; Sulfuric Acid, Monohexyl Ester, Magnesium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26MgO8S2 |
| Molecular Weight | 386.76 |
| CAS Registry Number | 72018-27-0 |
| EINECS | 276-302-3 |
| SMILES | C(O[S](=O)(=O)[O-])CCCCC.C(O[S](=O)(=O)[O-])CCCCC.[Mg++] |
| InChI | 1S/2C6H14O4S.Mg/c2*1-2-3-4-5-6-10-11(7,8)9;/h2*2-6H2,1H3,(H,7,8,9);/q;;+2/p-2 |
| InChIKey | HSNZBQFMWAGXCG-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Magnesium Hexyl Sulfate |