|
CAS#: 72041-34-0 Product: 2,3-Dihydrodicyclopenta(c,lmn)Phenanthren-1(9H)-One No suppilers available for the product. |
| Name | 2,3-Dihydrodicyclopenta(c,lmn)Phenanthren-1(9H)-One |
|---|---|
| Synonyms | Ccris 2474; Dicyclopenta(A,Def)Phenanthren-6(4H)-One, 7,8-Dihydro (9Ci); 15,16-Dihydro-1,11-Methanocyclopenta(A)Phenanthren-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 72041-34-0 |
| SMILES | C2=C1CC4=C3C1=C(C=C2)C=CC3=C5C(=C4)C(CC5)=O |
| InChI | 1S/C18H12O/c19-16-7-6-13-14-5-4-10-2-1-3-11-8-12(9-15(13)16)18(14)17(10)11/h1-5,9H,6-8H2 |
| InChIKey | GQEAXOLSWXBKCS-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.102°C at 760 mmHg (Cal.) |
| Flash point | 225.227°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydrodicyclopenta(c,lmn)Phenanthren-1(9H)-One |