Online Database of Chemicals from Around the World
|
CAS#: 7205-16-5 Product: Phosphorothioic acid O,O-dimethyl S-(phenylmethyl) ester No suppilers available for the product. |
| Name | Phosphorothioic acid O,O-dimethyl S-(phenylmethyl) ester |
|---|---|
| Synonyms | (Dimethoxyphosphorylthio)Methylbenzene; O,O-Dimethyl S-(Phenylmethyl) Ester Phosphorothioic Acid; Phosphorothioic Acid, O,O-Dimethyl S-(Phenylmethyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C9H13O3PS |
| Molecular Weight | 232.23 |
| CAS Registry Number | 7205-16-5 |
| SMILES | C1=CC=CC=C1CS[P](OC)(=O)OC |
| InChI | 1S/C9H13O3PS/c1-11-13(10,12-2)14-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | IIQZMUBPITYEIO-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.488°C at 760 mmHg (Cal.) |
| Flash point | 136.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphorothioic acid O,O-dimethyl S-(phenylmethyl) ester |