|
CAS#: 72076-54-1 Product: 6-Methyl-2-(Phenylthio)Quinoline No suppilers available for the product. |
| Name | 6-Methyl-2-(Phenylthio)Quinoline |
|---|---|
| Synonyms | 6-Methyl-2-Phenylsulfanyl-Quinoline; 6-Methyl-2-(Phenylthio)Quinoline; Quinoline, 6-Methyl-2-(Phenylthio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 |
| CAS Registry Number | 72076-54-1 |
| SMILES | C1=C(C=CC=C1)SC2=CC=C3C(=N2)C=CC(=C3)C |
| InChI | 1S/C16H13NS/c1-12-7-9-15-13(11-12)8-10-16(17-15)18-14-5-3-2-4-6-14/h2-11H,1H3 |
| InChIKey | MGBKIXGPXJZRIR-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.405°C at 760 mmHg (Cal.) |
| Flash point | 209.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-2-(Phenylthio)Quinoline |