|
CAS#: 7211-75-8 Product: 1,6-Dimethyl-2-oxo-1,2-dihydro-4-pyridinyl acetate No suppilers available for the product. |
| Name | 1,6-Dimethyl-2-oxo-1,2-dihydro-4-pyridinyl acetate |
|---|---|
| Synonyms | 1,6-Dimethyl-2-oxo-1,2-dihydro-4-pyridinyl acetate # |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 7211-75-8 |
| SMILES | O=C1/C=C(/OC(=O)C)\C=C(/N1C)C |
| InChI | 1S/C9H11NO3/c1-6-4-8(13-7(2)11)5-9(12)10(6)3/h4-5H,1-3H3 |
| InChIKey | NIHLRIUJTFZUME-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.833°C at 760 mmHg (Cal.) |
| Flash point | 137.554°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dimethyl-2-oxo-1,2-dihydro-4-pyridinyl acetate |