|
CAS#: 7212-40-0 Product: trans-1-Methyl-4-(1-Methylvinyl)Cyclohex-2-En-1-Ol No suppilers available for the product. |
| Name | trans-1-Methyl-4-(1-Methylvinyl)Cyclohex-2-En-1-Ol |
|---|---|
| Synonyms | (1R,4R)-4-Isopropenyl-1-Methyl-Cyclohex-2-En-1-Ol; (1R,4R)-4-Isopropenyl-1-Methyl-1-Cyclohex-2-Enol; (1R,4R)-1-Methyl-4-Prop-1-En-2-Yl-Cyclohex-2-En-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 |
| CAS Registry Number | 7212-40-0 |
| EINECS | 230-595-4 |
| SMILES | [C@@]1(O)(C=C[C@@H](CC1)C(=C)C)C |
| InChI | 1S/C10H16O/c1-8(2)9-4-6-10(3,11)7-5-9/h4,6,9,11H,1,5,7H2,2-3H3/t9-,10-/m0/s1 |
| InChIKey | MKPMHJQMNACGDI-UWVGGRQHSA-N |
| Density | 0.947g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.873°C at 760 mmHg (Cal.) |
| Flash point | 86.957°C (Cal.) |
| (1) | Xiong et al.. Cannabinoid potentiation of glycine receptors contributes to cannabis-induced analgesia, Nature Chemical Biology, 2011 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for trans-1-Methyl-4-(1-Methylvinyl)Cyclohex-2-En-1-Ol |