|
CAS#: 72156-36-6 Product: Butanedioic Acid; 2-(Tert-Butylamino)-1-Phenylethanol; 2-(Tert-Butylamino)-1-Phenylethanol No suppilers available for the product. |
| Name | Butanedioic Acid; 2-(Tert-Butylamino)-1-Phenylethanol; 2-(Tert-Butylamino)-1-Phenylethanol |
|---|---|
| Synonyms | 2-(Tert-Butylamino)-1-Phenyl-Ethanol; 2-(Tert-Butylamino)-1-Phenyl-Ethanol; Succinic Acid; 2-(Tert-Butylamino)-1-Phenylethanol; 2-(Tert-Butylamino)-1-Phenylethanol; Succinic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.67 |
| CAS Registry Number | 72156-36-6 |
| SMILES | C1=C(C(O)CNC(C)(C)C)C=CC=C1.C2=C(C(O)CNC(C)(C)C)C=CC=C2.C(C(=O)O)CC(=O)O |
| InChI | 1S/2C12H19NO.C4H6O4/c2*1-12(2,3)13-9-11(14)10-7-5-4-6-8-10;5-3(6)1-2-4(7)8/h2*4-8,11,13-14H,9H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | JLRFMXPIUXIYSN-UHFFFAOYSA-N |
| Boiling point | 284°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 80.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butanedioic Acid; 2-(Tert-Butylamino)-1-Phenylethanol; 2-(Tert-Butylamino)-1-Phenylethanol |