|
CAS#: 721958-41-4 Product: 5-Ethyl-5-(4-fluorophenyl)-2-methyl-1,5-dihydro-4H-imidazol-4-one No suppilers available for the product. |
| Name | 5-Ethyl-5-(4-fluorophenyl)-2-methyl-1,5-dihydro-4H-imidazol-4-one |
|---|---|
| Synonyms | 5-ethyl-5-(4-fluorophenyl)-2-methyl-1H-imidazol-4(5H)-one |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.24 |
| CAS Registry Number | 721958-41-4 |
| SMILES | CCC1(C(=O)N=C(N1)C)c2ccc(cc2)F |
| InChI | 1S/C12H13FN2O/c1-3-12(11(16)14-8(2)15-12)9-4-6-10(13)7-5-9/h4-7H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | NSFDGBXWNRIILW-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.141°C at 760 mmHg (Cal.) |
| Flash point | 137.135°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-5-(4-fluorophenyl)-2-methyl-1,5-dihydro-4H-imidazol-4-one |