|
CAS#: 7220-39-5 Product: Quinolin-8-Yloxyphosphonic Acid No suppilers available for the product. |
| Name | Quinolin-8-Yloxyphosphonic Acid |
|---|---|
| Synonyms | 8-Quinolyl Dihydrogen Phosphate; 8-Quinolinol, Monophosphate; 8-Quinolinol, Dihydrogen Phosphate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8NO4P |
| Molecular Weight | 225.14 |
| CAS Registry Number | 7220-39-5 |
| SMILES | C2=NC1=C(O[P](=O)(O)O)C=CC=C1C=C2 |
| InChI | 1S/C9H8NO4P/c11-15(12,13)14-8-5-1-3-7-4-2-6-10-9(7)8/h1-6H,(H2,11,12,13) |
| InChIKey | ZECSTTAOTMSGAM-UHFFFAOYSA-N |
| Density | 1.57g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.821°C at 760 mmHg (Cal.) |
| Flash point | 237.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Quinolin-8-Yloxyphosphonic Acid |