|
CAS#: 72235-46-2 Product: 3-(Dibromomethyl)Benzophenone No suppilers available for the product. |
| Name | 3-(Dibromomethyl)Benzophenone |
|---|---|
| Synonyms | [3-(Dibromomethyl)Phenyl]-Phenyl-Methanone; Nsc151989 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Br2O |
| Molecular Weight | 354.04 |
| CAS Registry Number | 72235-46-2 |
| SMILES | C1=CC=CC=C1C(C2=CC(=CC=C2)C(Br)Br)=O |
| InChI | 1S/C14H10Br2O/c15-14(16)12-8-4-7-11(9-12)13(17)10-5-2-1-3-6-10/h1-9,14H |
| InChIKey | OJXOSDREVZTZEF-UHFFFAOYSA-N |
| Density | 1.678g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.79°C at 760 mmHg (Cal.) |
| Flash point | 116.456°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dibromomethyl)Benzophenone |