|
CAS#: 7226-43-9 Product: 2-[2-(4,4-Dimethyl-5-oxo-1,3-oxazol-2-yl)propan-2-yl]isoindole-1,3-dione No suppilers available for the product. |
| Name | 2-[2-(4,4-Dimethyl-5-oxo-1,3-oxazol-2-yl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| Synonyms | 2-[1-(4,4-Dimethyl-5-Oxo-Oxazol-2-Yl)-1-Methyl-Ethyl]Isoindoline-1,3-Dione; 2-[1-(4,4-Dimethyl-5-Oxo-2-Oxazolyl)-1-Methylethyl]Isoindoline-1,3-Dione; 2-[1-(5-Keto-4,4-Dimethyl-Oxazol-2-Yl)-1-Methyl-Ethyl]Isoindoline-1,3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 |
| CAS Registry Number | 7226-43-9 |
| SMILES | C1=CC=CC3=C1C(N(C(C2=NC(C)(C(=O)O2)C)(C)C)C3=O)=O |
| InChI | 1S/C16H16N2O4/c1-15(2)14(21)22-13(17-15)16(3,4)18-11(19)9-7-5-6-8-10(9)12(18)20/h5-8H,1-4H3 |
| InChIKey | CZTRIRLPXCZXPY-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.829°C at 760 mmHg (Cal.) |
| Flash point | 196.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(4,4-Dimethyl-5-oxo-1,3-oxazol-2-yl)propan-2-yl]isoindole-1,3-dione |