|
CAS#: 72283-34-2 Product: Disodium 2-Butoxyethyl Phosphate No suppilers available for the product. |
| Name | Disodium 2-Butoxyethyl Phosphate |
|---|---|
| Synonyms | Ethanol, 2-Butoxy-, Phosphate, Sodium Salt; Einecs 286-317-7 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13Na2O5P |
| Molecular Weight | 242.12 |
| CAS Registry Number | 72283-34-2 (85204-22-4) |
| EINECS | 276-572-2 |
| SMILES | C(O[P]([O-])([O-])=O)COCCCC.[Na+].[Na+] |
| InChI | 1S/C6H15O5P.2Na/c1-2-3-4-10-5-6-11-12(7,8)9;;/h2-6H2,1H3,(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | MPFVDKFRCLZQKV-UHFFFAOYSA-L |
| Boiling point | 324.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 150.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium 2-Butoxyethyl Phosphate |