|
CAS#: 7238-59-7 Product: 5-Allylthiophen-2(5H)-One No suppilers available for the product. |
| Name | 5-Allylthiophen-2(5H)-One |
|---|---|
| Synonyms | Methyl (Z)-3-Methylamino-2-Nitroprop-2-Enoate; Methyl 3-Methylamino-2-Nitro-Prop-2-Enoate; Methyl (Z)-3-Methylamino-2-Nitro-Prop-2-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 |
| CAS Registry Number | 7238-59-7 |
| SMILES | COC(=O)\C([N+]([O-])=O)=C\NC |
| InChI | 1S/C5H8N2O4/c1-6-3-4(7(9)10)5(8)11-2/h3,6H,1-2H3/b4-3- |
| InChIKey | RXWOUPVJLJWTOD-ARJAWSKDSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.878°C at 760 mmHg (Cal.) |
| Flash point | 101.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Allylthiophen-2(5H)-One |