|
CAS#: 72453-56-6 Product: N-[4-[Bis[(2R)-Butan-2-Yl]Amino]Phenyl]Heptanamide No suppilers available for the product. |
| Name | N-[4-[Bis[(2R)-Butan-2-Yl]Amino]Phenyl]Heptanamide |
|---|---|
| Synonyms | N-[4-(Disec-Butylamino)Phenyl]Heptanamide; N-[4-(Disec-Butylamino)Phenyl]Enanthamide; N-Heptanoyl-N',N'-Di-Sec-Butyl-P-Phenylenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 |
| CAS Registry Number | 72453-56-6 |
| SMILES | [C@H](N(C1=CC=C(C=C1)NC(=O)CCCCCC)[C@@H](CC)C)(CC)C |
| InChI | 1S/C21H36N2O/c1-6-9-10-11-12-21(24)22-19-13-15-20(16-14-19)23(17(4)7-2)18(5)8-3/h13-18H,6-12H2,1-5H3,(H,22,24)/t17-,18-/m1/s1 |
| InChIKey | XCUBRVVJLABQLN-QZTJIDSGSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.119°C at 760 mmHg (Cal.) |
| Flash point | 247.796°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-[Bis[(2R)-Butan-2-Yl]Amino]Phenyl]Heptanamide |