|
CAS#: 7248-49-9 Product: 2-[(4-Methylnaphthalen-1-Yl)Methyl]Benzoic Acid No suppilers available for the product. |
| Name | 2-[(4-Methylnaphthalen-1-Yl)Methyl]Benzoic Acid |
|---|---|
| Synonyms | 2-[(4-Methyl-1-Naphthyl)Methyl]Benzoic Acid; Nsc16074 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 7248-49-9 |
| SMILES | C1=CC(=C(C=C1)CC2=CC=C(C)C3=C2C=CC=C3)C(O)=O |
| InChI | 1S/C19H16O2/c1-13-10-11-15(17-8-5-4-7-16(13)17)12-14-6-2-3-9-18(14)19(20)21/h2-11H,12H2,1H3,(H,20,21) |
| InChIKey | RLDJKCMERDFQPG-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.685°C at 760 mmHg (Cal.) |
| Flash point | 213.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Methylnaphthalen-1-Yl)Methyl]Benzoic Acid |