|
CAS#: 72493-39-1 Product: 3-[1-(2,5-Dimethyl-3-furyl)ethylidene]-4-isopropylidenedihydro-2,5-furandione No suppilers available for the product. |
| Name | 3-[1-(2,5-Dimethyl-3-furyl)ethylidene]-4-isopropylidenedihydro-2,5-furandione |
|---|---|
| Synonyms | TRANS-2-( |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 72493-39-1 |
| SMILES | Cc1cc(c(o1)C)C(=C2C(=C(C)C)C(=O)OC2=O)C |
| InChI | 1S/C15H16O4/c1-7(2)12-13(15(17)19-14(12)16)9(4)11-6-8(3)18-10(11)5/h6H,1-5H3 |
| InChIKey | ITMSLXOTORBGQJ-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.47°C at 760 mmHg (Cal.) |
| Flash point | 185.716°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[1-(2,5-Dimethyl-3-furyl)ethylidene]-4-isopropylidenedihydro-2,5-furandione |