|
CAS#: 7251-36-7 Product: 2-(Tribromomethyl)Quinoxaline No suppilers available for the product. |
| Name | 2-(Tribromomethyl)Quinoxaline |
|---|---|
| Synonyms | 2-Tribromomethylquinoxaline; 4-23-00-01253 (Beilstein Handbook Reference); Brn 0157314 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5Br3N2 |
| Molecular Weight | 380.86 |
| CAS Registry Number | 7251-36-7 |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C(Br)(Br)Br |
| InChI | 1S/C9H5Br3N2/c10-9(11,12)8-5-13-6-3-1-2-4-7(6)14-8/h1-5H |
| InChIKey | VCCOPRMZNNMFLI-UHFFFAOYSA-N |
| Density | 2.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.034°C at 760 mmHg (Cal.) |
| Flash point | 176.381°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(Tribromomethyl)Quinoxaline |