|
CAS#: 72541-00-5 Product: Eugarzasidine I No suppilers available for the product. |
| Name | Eugarzasidine I |
|---|---|
| Synonyms | Teucvin; Nsc258599; Spiro[Furan-3(2H),6'-[6H]Naphtho[1,8-Bc]Furan]-2,2'(4'H)-Dione, 5-(3-Furanyl)-3',4,5,5',5'A,7',8',8'A-Octahydro-7'-Methyl-, [5'Ar-[5'A.Alpha.,6'.Alpha.(S*),7'.Alpha.,8'A.Alpha.]]- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 |
| CAS Registry Number | 72541-00-5 (53625-15-3) |
| SMILES | C5=C(C1CC3(C(O1)=O)C4C2=C(C(=O)OC2CC3C)CCC4)C=CO5 |
| InChI | 1S/C19H20O5/c1-10-7-14-16-12(17(20)23-14)3-2-4-13(16)19(10)8-15(24-18(19)21)11-5-6-22-9-11/h5-6,9-10,13-15H,2-4,7-8H2,1H3 |
| InChIKey | XJRMFKRYVTYFPN-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.266°C at 760 mmHg (Cal.) |
| Flash point | 310.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Eugarzasidine I |