|
CAS#: 7256-05-5 Product: 6-Tert-Butyl-4-Nitroso-O-Cresol No suppilers available for the product. |
| Name | 6-Tert-Butyl-4-Nitroso-O-Cresol |
|---|---|
| Synonyms | 2-Tert-Butyl-6-Methyl-4-Nitroso-Phenol; Ai3-19050; Nsc21496 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 |
| CAS Registry Number | 7256-05-5 |
| EINECS | 230-676-4 |
| SMILES | C1=C(C=C(C(=C1C(C)(C)C)O)C)N=O |
| InChI | 1S/C11H15NO2/c1-7-5-8(12-14)6-9(10(7)13)11(2,3)4/h5-6,13H,1-4H3 |
| InChIKey | OWQGDXJYRASCMS-UHFFFAOYSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.583°C at 760 mmHg (Cal.) |
| Flash point | 141.636°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Tert-Butyl-4-Nitroso-O-Cresol |