Online Database of Chemicals from Around the World
|
CAS#: 7258-91-5 Product: Phenanthra-Acenaphthene No suppilers available for the product. |
| Name | Phenanthra-Acenaphthene |
|---|---|
| Synonyms | Phenanthra-Acenaphthene; 3-05-00-02596 (Beilstein Handbook Reference); Brn 3141944 |
| Molecular Structure |  |
| Molecular Formula | C24H16 |
| Molecular Weight | 304.39 |
| CAS Registry Number | 7258-91-5 |
| SMILES | C6=C4C3=CC2=CC=C1C=CC=CC1=C2C=C3C=C5CCC(=C45)C=C6 |
| InChI | 1S/C24H16/c1-2-6-20-15(4-1)8-10-17-13-23-19(14-22(17)20)12-18-11-9-16-5-3-7-21(23)24(16)18/h1-8,10,12-14H,9,11H2 |
| InChIKey | FIEFWFHQVMTKCB-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.711°C at 760 mmHg (Cal.) |
| Flash point | 297.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthra-Acenaphthene |