|
CAS#: 72649-87-7 Product: 2-[(2,3,5,6-Tetramethylphenyl)Methyl]-4,5-Dihydro-1H-Imidazole Hydrochloride No suppilers available for the product. |
| Name | 2-[(2,3,5,6-Tetramethylphenyl)Methyl]-4,5-Dihydro-1H-Imidazole Hydrochloride |
|---|---|
| Synonyms | 2-(2,3,5,6-Tetramethylbenzyl)-4,5-Dihydro-1H-Imidazole Hydrochloride; 1H-Imidazole, 4,5-Dihydro-2-((2,3,5,6-Tetramethylphenyl)Methyl)-, Monohydrochloride; 2-(2,3,5,6-Tetrametilbenzil)Imidazolina Hcl [Italian] |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 |
| CAS Registry Number | 72649-87-7 |
| SMILES | [H+].C1=C(C(=C(C(=C1C)C)CC2=NCCN2)C)C.[Cl-] |
| InChI | 1S/C14H20N2.ClH/c1-9-7-10(2)12(4)13(11(9)3)8-14-15-5-6-16-14;/h7H,5-6,8H2,1-4H3,(H,15,16);1H |
| InChIKey | QPVJHMJCDNRCFC-UHFFFAOYSA-N |
| Boiling point | 400.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,3,5,6-Tetramethylphenyl)Methyl]-4,5-Dihydro-1H-Imidazole Hydrochloride |