|
CAS#: 7271-73-0 Product: 2-[(5H-Dibenzo[a,d]Cyclohepten-5-Yl)Sulfonyl]-N,N-Dimethylethanamine No suppilers available for the product. |
| Name | 2-[(5H-Dibenzo[a,d]Cyclohepten-5-Yl)Sulfonyl]-N,N-Dimethylethanamine |
|---|---|
| Synonyms | Brn 2477074; Ethylamine, 2-((5H-Dibenzo(A,D)Cyclohepten-5-Yl)Sulfonyl)-N,N-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.44 |
| CAS Registry Number | 7271-73-0 |
| SMILES | C1=CC=CC2=C1C([S](=O)(=O)CCN(C)C)C3=C(C=C2)C=CC=C3 |
| InChI | 1S/C19H21NO2S/c1-20(2)13-14-23(21,22)19-17-9-5-3-7-15(17)11-12-16-8-4-6-10-18(16)19/h3-12,19H,13-14H2,1-2H3 |
| InChIKey | DCMRDTVQRGJUBV-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.416°C at 760 mmHg (Cal.) |
| Flash point | 277.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(5H-Dibenzo[a,d]Cyclohepten-5-Yl)Sulfonyl]-N,N-Dimethylethanamine |