|
CAS#: 72716-71-3 Product: 5-(1,3-Benzodioxol-5-ylmethyl)-2-(nitroamino)-4(1H)-pyrimidinone No suppilers available for the product. |
| Name | 5-(1,3-Benzodioxol-5-ylmethyl)-2-(nitroamino)-4(1H)-pyrimidinone |
|---|---|
| Synonyms | 5-(1,3-be |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.23 |
| CAS Registry Number | 72716-71-3 |
| EINECS | 276-779-8 |
| SMILES | [O-][N+](=O)NC1=NC(=O)C(=CN1)Cc2ccc3OCOc3c2 |
| InChI | 1S/C12H10N4O5/c17-11-8(5-13-12(14-11)15-16(18)19)3-7-1-2-9-10(4-7)21-6-20-9/h1-2,4-5H,3,6H2,(H2,13,14,15,17) |
| InChIKey | CYDVFWXIUURXJS-UHFFFAOYSA-N |
| Density | 1.707g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.361°C at 760 mmHg (Cal.) |
| Flash point | 255.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1,3-Benzodioxol-5-ylmethyl)-2-(nitroamino)-4(1H)-pyrimidinone |