|
CAS#: 72746-33-9 Product: (9-cis, 9'-cis)-7,7',8,8'-Tetrahydro-psi,psi-Carotene No suppilers available for the product. |
| Name | (9-cis, 9'-cis)-7,7',8,8'-Tetrahydro-psi,psi-Carotene |
|---|---|
| Synonyms | C15857; Psi,Psi-Carotene, 7,7',8,8'-Tetrahydro-, (9-Cis,9'-Cis)-; 9,9'-Di-Cis-Zeta-Carotene |
| Molecular Structure | ![]() |
| Molecular Formula | C40H60 |
| Molecular Weight | 540.91 |
| CAS Registry Number | 72746-33-9 |
| SMILES | C(C=C(C)C)C\C(=C\CC\C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(\CC/C=C(/CCC=C(C)C)C)C)C)C)C)C |
| InChI | 1S/C40H60/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-16,19-22,25-30H,13-14,17-18,23-24,31-32H2,1-10H3/b12-11+,25-15+,26-16+,35-21+,36-22+,37-27+,38-28+,39-29-,40-30- |
| InChIKey | BIWLELKAFXRPDE-ZURBLSRNSA-N |
| Density | 0.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 640.806°C at 760 mmHg (Cal.) |
| Flash point | 341.974°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (9-cis, 9'-cis)-7,7',8,8'-Tetrahydro-psi,psi-Carotene |