|
CAS#: 72828-15-0 Product: Azane; 1,2-Di(Ethenyl)Benzene; Styrene No suppilers available for the product. |
| Name | Azane; 1,2-Di(Ethenyl)Benzene; Styrene |
|---|---|
| Synonyms | Ammonia; 1,2-Divinylbenzene; Styrene; Azane; 1,2-Di(Ethenyl)Benzene; Ethenylbenzene |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 |
| CAS Registry Number | 72828-15-0 |
| SMILES | C1=C(C(=CC=C1)C=C)C=C.C2=C(C=CC=C2)C=C.N |
| InChI | 1S/C10H10.C8H8.H3N/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;/h3-8H,1-2H2;2-7H,1H2;1H3 |
| InChIKey | PRNNQCQBCJDOGS-UHFFFAOYSA-N |
| Boiling point | 207.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 71.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azane; 1,2-Di(Ethenyl)Benzene; Styrene |