|
CAS#: 72829-37-9 Product: 1-Amino-5-Dimethylamino-4,8-Dihydroxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1-Amino-5-Dimethylamino-4,8-Dihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 1-Amino-5-Dimethylamino-4,8-Dihydroxy-Anthracene-9,10-Dione; 1-Amino-5-Dimethylamino-4,8-Dihydroxy-9,10-Anthraquinone; 9,10-Anthracenedione, 1-Amino-5-(Dimethylamino)-4,8-Dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 |
| CAS Registry Number | 72829-37-9 |
| SMILES | C1=CC(=C3C(=C1O)C(=O)C2=C(C(=CC=C2N(C)C)O)C3=O)N |
| InChI | 1S/C16H14N2O4/c1-18(2)8-4-6-10(20)14-12(8)16(22)13-9(19)5-3-7(17)11(13)15(14)21/h3-6,19-20H,17H2,1-2H3 |
| InChIKey | CXGKWAGMKSPJMF-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 623.859°C at 760 mmHg (Cal.) |
| Flash point | 331.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-5-Dimethylamino-4,8-Dihydroxyanthracene-9,10-Dione |