|
CAS#: 7284-69-7 Product: 4-Nitrophenyl Di-N-Pentylphosphinate No suppilers available for the product. |
| Name | 4-Nitrophenyl Di-N-Pentylphosphinate |
|---|---|
| Synonyms | 1-Dipentylphosphoryloxy-4-Nitro-Benzene; 1-Diamylphosphoryloxy-4-Nitro-Benzene; Phosphinic Acid, Dipentyl-, 4-Nitrophenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26NO4P |
| Molecular Weight | 327.36 |
| CAS Registry Number | 7284-69-7 |
| SMILES | C1=C(O[P](=O)(CCCCC)CCCCC)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C16H26NO4P/c1-3-5-7-13-22(20,14-8-6-4-2)21-16-11-9-15(10-12-16)17(18)19/h9-12H,3-8,13-14H2,1-2H3 |
| InChIKey | XZCMEWITQIIWBJ-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.988°C at 760 mmHg (Cal.) |
| Flash point | 215.664°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl Di-N-Pentylphosphinate |