|
CAS#: 72845-40-0 Product: [(E)-2-Methylbut-2-Enyl] (E)-2-Methylbut-2-Enoate No suppilers available for the product. |
| Name | [(E)-2-Methylbut-2-Enyl] (E)-2-Methylbut-2-Enoate |
|---|---|
| Synonyms | 2-Methylbut-2-Enyl 2-Methylbut-2-Enoate; (E)-2-Methylbut-2-Enoic Acid [(E)-2-Methylbut-2-Enyl] Ester; 2-Methylbut-2-Enoic Acid 2-Methylbut-2-Enyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 72845-40-0 (73003-76-6) |
| SMILES | C(OC(=O)C(=C/C)/C)\C(=C\C)C |
| InChI | 1S/C10H16O2/c1-5-8(3)7-12-10(11)9(4)6-2/h5-6H,7H2,1-4H3/b8-5+,9-6+ |
| InChIKey | QJXVZKLQKPUDPW-XVYDYJIPSA-N |
| Density | 0.915g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.214°C at 760 mmHg (Cal.) |
| Flash point | 88.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-2-Methylbut-2-Enyl] (E)-2-Methylbut-2-Enoate |