|
CAS#: 72878-47-8 Product: 6-Succinylcodeine No suppilers available for the product. |
| Name | 6-Succinylcodeine |
|---|---|
| Synonyms | Morphinan-6-Ol, 7,8-Didehydro-4,5-Epoxy-3-Methoxy-17-Methyl-, Butanedioate (1:1) (Ester), (5Alpha,6Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 |
| CAS Registry Number | 72878-47-8 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@H]1C=C[C@@H]([C@@H]2OC3=C(C=C4)OC)OC(CCC(O)=O)=O)CCN5C |
| InChI | 1S/C22H25NO6/c1-23-10-9-22-13-4-6-16(28-18(26)8-7-17(24)25)21(22)29-20-15(27-2)5-3-12(19(20)22)11-14(13)23/h3-6,13-14,16,21H,7-11H2,1-2H3,(H,24,25)/t13-,14+,16-,21-,22-/m0/s1 |
| InChIKey | YTFGQBAWQOQQBO-NEKAMENDSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.019°C at 760 mmHg (Cal.) |
| Flash point | 305.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Succinylcodeine |