|
CAS#: 72908-01-1 Product: 2-(8-Hydroxy-3H-Cyclopenta[a]Naphthalen-2-Yl)Acetamide No suppilers available for the product. |
| Name | 2-(8-Hydroxy-3H-Cyclopenta[a]Naphthalen-2-Yl)Acetamide |
|---|---|
| Synonyms | 2-(8-Hydroxy-3H-Cyclopenta[A]Naphthalen-2-Yl)Ethanamide; Nsc325674; 2-(Carbamylmethyl)-8-Hydroxy-3H-Cyclopenta(A)Naphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 72908-01-1 |
| SMILES | C2=CC1=C(C=C(C1)CC(=O)N)C3=CC(=CC=C23)O |
| InChI | 1S/C15H13NO2/c16-15(18)7-9-5-11-2-1-10-3-4-12(17)8-14(10)13(11)6-9/h1-4,6,8,17H,5,7H2,(H2,16,18) |
| InChIKey | ZDYLTZBERJPKKA-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.417°C at 760 mmHg (Cal.) |
| Flash point | 276.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(8-Hydroxy-3H-Cyclopenta[a]Naphthalen-2-Yl)Acetamide |