Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Octahydro-3,3,5,5-Tetramethyl-2(1H)-Naphthalenone |
|---|---|
| Synonyms | 3,3,5,5-Tetramethyldecalin-2-One; 3,3,5,5-Tetramethyl-2-Decalinone; 2(1H)-Naphthalenone, Octahydro-3,3,5,5-Tetramethyl- |
| Molecular Structure |  |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 72927-88-9 |
| EINECS | 277-029-2 |
| SMILES | CC2(C1C(CC(=O)C(C1)(C)C)CCC2)C |
| InChI | 1S/C14H24O/c1-13(2)7-5-6-10-8-12(15)14(3,4)9-11(10)13/h10-11H,5-9H2,1-4H3 |
| InChIKey | DGPIAHAFWKJURE-UHFFFAOYSA-N |
| Density | 0.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.063°C at 760 mmHg (Cal.) |
| Flash point | 110.887°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-3,3,5,5-Tetramethyl-2(1H)-Naphthalenone |